Customization: | Available |
---|---|
CAS No.: | 2530-85-0 |
Formula: | CH2=CH(CH3)Coo(CH2)3si(Och3)3 |
Still deciding? Get samples of US$ 1/Piece
Request Sample
|
Suppliers with verified business licenses
Audited by an independent third-party inspection agency
Improve the mechanical properties of the composite material
Strengthen the pollution-resistance
Increase the cohesive force
Product List | |||||||||
Functional Group | NAME | Chemical Name in English | CAS NO. | Momentive(GE) | Degussa | Dow Corning | Shin- Etsu | Wacker | |
Special Silane Coupling Agent | GX-670(KH-670) | y-Methacryloxypropyltriethoxysilane | 21142-29-0 | KBE-503 | |||||
GX-671(KH-671) | y-Methacryloxypropylmethyldiethoxysilane | 65100-04-1 | KBE-502 | ||||||
GX-571(KH-571) | 3- Methacryloxypropylmethyldimethoxysilane |
14513-34-9 | Z-6033 | KBM-502 | |||||
GX-540(KH-540) | y-Aminopropyltrimethoxysilane | 13822-56-5 | A-1110 | Z-6610 | KBM-903 | ||||
GX-902(KH-902) | 3-Aminopropyl methyldiethoxy silane | 3179-76-8 | Z-6015 | KBE-902 | |||||
GX-910(KH-910) | N-(2-aminoethyl)-y- aminopropyltrimethoxysilane |
5089-72-5 | KBE-603 | ||||||
GX-1160(KH-1160) | 3-Ureidopropyltriethoxysilane | 23779-32-0 | A-1160 | Z-6676 | KBE-585 | ||||
GX-1524 | 3-Ureidopropyltrimethoxysilane | 23843-64-3 | A-1524 | ||||||
GX-1146 | Diamino-silane oligomers | Dynasylan1146 | |||||||
GX-1189 | N-(3-trimethoxysilyl)propyl)butylamine | 31024-56-3 | Dynasylan1189 | ||||||
Water- born silane | mixture of amino silane | ||||||||
common silane coupling agent | GX-570(KH-570) | 3-(Methylacryloxyl)-propyltrimethoxy silane | 2530-85-0 | A-174 | MEMO | Z-6030 | KBM-503 | GF31 | |
GX-550(KH-550) | y-Aminopropyltriethoxysilane | 919-30-2 | A-1100 | Z-6011 | KBE-903 | ||||
GX-560(KH-560) | 3-Glycidoxypropyltriethoxysilane | 2530-83-8 | A-187 | Z-6040 | KBM-403 | ||||
GX-602(KH-602) | N-(2-aminoethyl)-Y- aminopropymethydimethoxysilane |
3069-29-2 | A-2120 | Z-6023 | KBM-602 | ||||
GX-792(KH-792) | N-(2-aminoethyl)-Y-aminopropytrimethoxysilane | 1760-24-3 | A-1120 | Z-6020 | KBM-603 | ||||
GX-151(KH-151) | Vinyltriethoxysilane | 78-08-0 | A-151 | Z-6518 | KBE-1003 | ||||
GX-171(KH-171) | Vinyltrimethoxysilane | 2768-2-7 | A-171 | Z-6300 | KBM-1003 | ||||
GX-172(KH-172) | Viny(2-methydimethoxy)silane | 1067-53-4 | A-172 | Z-2380 |